C22H20N2O5S — CID 28569989
(5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 28569989) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 28569989 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | Cc1cc(COC(=O)/C=C/c2ccc(S(=O)(=O)N3CCc4ccccc43)cc2)no1 |
| InChI | InChI=1S/C22H20N2O5S/c1-16-14-19(23-29-16)15-28-22(25)11-8-17-6-9-20(10-7-17)30(26,27)24-13-12-18-4-2-3-5-21(18)24/h2-11,14H,12-13,15H2,1H3/b11-8+ |
| InChIKey | OTUXANOAWVHHNZ-DHZHZOJOSA-N |
| XLogP | 3.49 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|