C24H19Cl2NO4S — CID 2379550
(2,4-dichlorophenyl)methyl (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 2379550) has the molecular formula C24H19Cl2NO4S and a molecular weight of 488.39 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | (2,4-dichlorophenyl)methyl (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2379550 |
| Molecular Formula | C24H19Cl2NO4S |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | (2,4-dichlorophenyl)methyl (E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)N2CCc3ccccc32)cc1)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H19Cl2NO4S/c25-20-9-8-19(22(26)15-20)16-31-24(28)12-7-17-5-10-21(11-6-17)32(29,30)27-14-13-18-3-1-2-4-23(18)27/h1-12,15H,13-14,16H2/b12-7+ |
| InChIKey | FBMUJXWWSPPQGU-KPKJPENVSA-N |
| XLogP | 5.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|