C29H29N3O6S — CID 4235920
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 4235920) has the molecular formula C29H29N3O6S and a molecular weight of 547.63 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 4235920 |
| Molecular Formula | C29H29N3O6S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C29H29N3O6S/c33-28(30-24-8-10-25(11-9-24)31-17-19-37-20-18-31)21-38-29(34)14-7-22-5-12-26(13-6-22)39(35,36)32-16-15-23-3-1-2-4-27(23)32/h1-14H,15-21H2,(H,30,33) |
| InChIKey | WYGBQXIBHLHQRO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|