C16H16N2O2 — CID 59997448
(3Z)-3-[[3-(2-hydroxyethyl)-4-methyl-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one (PubChem CID 59997448) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (3Z)-3-[[3-(2-hydroxyethyl)-4-methyl-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[[3-(2-hydroxyethyl)-4-methyl-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 59997448 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (3Z)-3-[[3-(2-hydroxyethyl)-4-methyl-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one |
| SMILES | Cc1c[nH]c(/C=C2\C(=O)Nc3ccccc32)c1CCO |
| InChI | InChI=1S/C16H16N2O2/c1-10-9-17-15(11(10)6-7-19)8-13-12-4-2-3-5-14(12)18-16(13)20/h2-5,8-9,17,19H,6-7H2,1H3,(H,18,20)/b13-8- |
| InChIKey | NYSHLUDSYSEMFH-JYRVWZFOSA-N |
| XLogP | 2.35 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|