C20H18N3O+ — CID 11314146
(3E)-3-[[3-methyl-5-(pyridin-1-ium-1-ylmethyl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one (PubChem CID 11314146) has the molecular formula C20H18N3O+ and a molecular weight of 316.38 g/mol. Its IUPAC name is (3E)-3-[[3-methyl-5-(pyridin-1-ium-1-ylmethyl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[[3-methyl-5-(pyridin-1-ium-1-ylmethyl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 11314146 |
| Molecular Formula | C20H18N3O+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (3E)-3-[[3-methyl-5-(pyridin-1-ium-1-ylmethyl)-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one |
| SMILES | Cc1cc(C[n+]2ccccc2)[nH]c1/C=C1/C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C20H17N3O/c1-14-11-15(13-23-9-5-2-6-10-23)21-19(14)12-17-16-7-3-4-8-18(16)22-20(17)24/h2-12H,13H2,1H3,(H-,21,22,24)/p+1 |
| InChIKey | MOQWZPRFIGXGQX-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|