C20H21N3O4 — CID 58923976
methyl 4-[[4-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carbonyl]amino]butanoate (PubChem CID 58923976) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is methyl 4-[[4-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[4-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 58923976 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | methyl 4-[[4-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1cc(C)c(/C=C2\C(=O)Nc3ccccc32)[nH]1 |
| InChI | InChI=1S/C20H21N3O4/c1-12-10-17(20(26)21-9-5-8-18(24)27-2)22-16(12)11-14-13-6-3-4-7-15(13)23-19(14)25/h3-4,6-7,10-11,22H,5,8-9H2,1-2H3,(H,21,26)(H,23,25)/b14-11- |
| InChIKey | GZNLODKHRYJMMO-KAMYIIQDSA-N |
| XLogP | 2.50 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|