C13H11Cl2NO — CID 70655963
(E)-1-[5-(3,4-dichlorophenyl)furan-2-yl]prop-1-en-2-amine (PubChem CID 70655963) has the molecular formula C13H11Cl2NO and a molecular weight of 268.14 g/mol. Its IUPAC name is (E)-1-[5-(3,4-dichlorophenyl)furan-2-yl]prop-1-en-2-amine.
| Compound Name | (E)-1-[5-(3,4-dichlorophenyl)furan-2-yl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 70655963 |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | (E)-1-[5-(3,4-dichlorophenyl)furan-2-yl]prop-1-en-2-amine |
| SMILES | C/C(N)=C\c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C13H11Cl2NO/c1-8(16)6-10-3-5-13(17-10)9-2-4-11(14)12(15)7-9/h2-7H,16H2,1H3/b8-6+ |
| InChIKey | HXYWTVOSLRBCQD-SOFGYWHQSA-N |
| XLogP | 4.57 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |