C19H16F3NO3 — CID 31150878
N-methyl-N-[(5-methylfuran-2-yl)methyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 31150878) has the molecular formula C19H16F3NO3 and a molecular weight of 363.34 g/mol. Its IUPAC name is N-methyl-N-[(5-methylfuran-2-yl)methyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-methyl-N-[(5-methylfuran-2-yl)methyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31150878 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-methyl-N-[(5-methylfuran-2-yl)methyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(CN(C)C(=O)c2ccc(-c3cccc(C(F)(F)F)c3)o2)o1 |
| InChI | InChI=1S/C19H16F3NO3/c1-12-6-7-15(25-12)11-23(2)18(24)17-9-8-16(26-17)13-4-3-5-14(10-13)19(20,21)22/h3-10H,11H2,1-2H3 |
| InChIKey | IJXGVZGARRXACW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |