C18H14F3NO2S — CID 56777615
N-methyl-N-(thiophen-2-ylmethyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 56777615) has the molecular formula C18H14F3NO2S and a molecular weight of 365.38 g/mol. Its IUPAC name is N-methyl-N-(thiophen-2-ylmethyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-methyl-N-(thiophen-2-ylmethyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 56777615 |
| Molecular Formula | C18H14F3NO2S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-methyl-N-(thiophen-2-ylmethyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | CN(Cc1cccs1)C(=O)c1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C18H14F3NO2S/c1-22(11-14-6-3-9-25-14)17(23)16-8-7-15(24-16)12-4-2-5-13(10-12)18(19,20)21/h2-10H,11H2,1H3 |
| InChIKey | STZREAOZGXTFHY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |