C31H35F3N2O — CID 57161044
[(2S,4S)-2-benzyl-4-[3-[3-(trifluoromethyl)phenyl]propylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone (PubChem CID 57161044) has the molecular formula C31H35F3N2O and a molecular weight of 508.63 g/mol. Its IUPAC name is [(2S,4S)-2-benzyl-4-[3-[3-(trifluoromethyl)phenyl]propylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone.
| Compound Name | [(2S,4S)-2-benzyl-4-[3-[3-(trifluoromethyl)phenyl]propylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 57161044 |
| Molecular Formula | C31H35F3N2O |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | [(2S,4S)-2-benzyl-4-[3-[3-(trifluoromethyl)phenyl]propylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C)cc(C(=O)N2CC[C@H](NCCCc3cccc(C(F)(F)F)c3)C[C@@H]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C31H35F3N2O/c1-22-16-23(2)18-26(17-22)30(37)36-15-13-28(21-29(36)20-25-8-4-3-5-9-25)35-14-7-11-24-10-6-12-27(19-24)31(32,33)34/h3-6,8-10,12,16-19,28-29,35H,7,11,13-15,20-21H2,1-2H3/t28-,29-/m0/s1 |
| InChIKey | GBOWJEXTHJQAJS-VMPREFPWSA-N |
| XLogP | 6.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|