C30H34N2O3 — CID 57167688
[(2R,4S)-2-benzyl-4-[2-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)ethylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone (PubChem CID 57167688) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is [(2R,4S)-2-benzyl-4-[2-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)ethylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone.
| Compound Name | [(2R,4S)-2-benzyl-4-[2-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)ethylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 57167688 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | [(2R,4S)-2-benzyl-4-[2-(2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-6-yl)ethylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C)cc(C(=O)N2CC[C@H](NCCc3ccc4cc3OCO4)C[C@H]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C30H34N2O3/c1-21-14-22(2)16-25(15-21)30(33)32-13-11-26(18-27(32)17-23-6-4-3-5-7-23)31-12-10-24-8-9-28-19-29(24)35-20-34-28/h3-9,14-16,19,26-27,31H,10-13,17-18,20H2,1-2H3/t26-,27+/m0/s1 |
| InChIKey | HJYNUKDQPYODEA-RRPNLBNLSA-N |
| XLogP | 5.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |