C32H40N2O3 — CID 57259688
[(2R,4S)-2-benzyl-4-[3-(2,5-dimethoxyphenyl)propylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone (PubChem CID 57259688) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is [(2R,4S)-2-benzyl-4-[3-(2,5-dimethoxyphenyl)propylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone.
| Compound Name | [(2R,4S)-2-benzyl-4-[3-(2,5-dimethoxyphenyl)propylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 57259688 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | [(2R,4S)-2-benzyl-4-[3-(2,5-dimethoxyphenyl)propylamino]piperidin-1-yl]-(3,5-dimethylphenyl)methanone |
| SMILES | COc1ccc(OC)c(CCCN[C@H]2CCN(C(=O)c3cc(C)cc(C)c3)[C@H](Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C32H40N2O3/c1-23-17-24(2)19-27(18-23)32(35)34-16-14-28(22-29(34)20-25-9-6-5-7-10-25)33-15-8-11-26-21-30(36-3)12-13-31(26)37-4/h5-7,9-10,12-13,17-19,21,28-29,33H,8,11,14-16,20,22H2,1-4H3/t28-,29+/m0/s1 |
| InChIKey | UMYHLOIKGLSKPP-URLMMPGGSA-N |
| XLogP | 5.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|