C14H16F3NO3 — CID 119357519
4-methyl-4-[[2-(2,4,5-trifluorophenyl)acetyl]amino]pentanoic acid (PubChem CID 119357519) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is 4-methyl-4-[[2-(2,4,5-trifluorophenyl)acetyl]amino]pentanoic acid.
| Compound Name | 4-methyl-4-[[2-(2,4,5-trifluorophenyl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119357519 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-methyl-4-[[2-(2,4,5-trifluorophenyl)acetyl]amino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H16F3NO3/c1-14(2,4-3-13(20)21)18-12(19)6-8-5-10(16)11(17)7-9(8)15/h5,7H,3-4,6H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | KKJFTSFIZJKJPH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|