C13H15Cl2FN2O3 — CID 122092588
4-[(4,5-dichloro-2-fluorophenyl)carbamoylamino]-4-methylpentanoic acid (PubChem CID 122092588) has the molecular formula C13H15Cl2FN2O3 and a molecular weight of 337.18 g/mol. Its IUPAC name is 4-[(4,5-dichloro-2-fluorophenyl)carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[(4,5-dichloro-2-fluorophenyl)carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122092588 |
| Molecular Formula | C13H15Cl2FN2O3 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-[(4,5-dichloro-2-fluorophenyl)carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)Nc1cc(Cl)c(Cl)cc1F |
| InChI | InChI=1S/C13H15Cl2FN2O3/c1-13(2,4-3-11(19)20)18-12(21)17-10-6-8(15)7(14)5-9(10)16/h5-6H,3-4H2,1-2H3,(H,19,20)(H2,17,18,21) |
| InChIKey | CTEHQKMFBVKTOW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|