C16H22F3N3O3 — CID 122074518
4-[[2-(dimethylamino)-5-(trifluoromethyl)phenyl]carbamoylamino]-4-methylpentanoic acid (PubChem CID 122074518) has the molecular formula C16H22F3N3O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)-5-(trifluoromethyl)phenyl]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[[2-(dimethylamino)-5-(trifluoromethyl)phenyl]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122074518 |
| Molecular Formula | C16H22F3N3O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 4-[[2-(dimethylamino)-5-(trifluoromethyl)phenyl]carbamoylamino]-4-methylpentanoic acid |
| SMILES | CN(C)c1ccc(C(F)(F)F)cc1NC(=O)NC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C16H22F3N3O3/c1-15(2,8-7-13(23)24)21-14(25)20-11-9-10(16(17,18)19)5-6-12(11)22(3)4/h5-6,9H,7-8H2,1-4H3,(H,23,24)(H2,20,21,25) |
| InChIKey | OZLBCLYTGZYDRM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |