C17H25ClN2O5 — CID 122091101
4-[[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]carbamoylamino]-4-methylpentanoic acid (PubChem CID 122091101) has the molecular formula C17H25ClN2O5 and a molecular weight of 372.85 g/mol. Its IUPAC name is 4-[[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122091101 |
| Molecular Formula | C17H25ClN2O5 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-[[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]carbamoylamino]-4-methylpentanoic acid |
| SMILES | COCC(C)Oc1ccc(Cl)cc1NC(=O)NC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C17H25ClN2O5/c1-11(10-24-4)25-14-6-5-12(18)9-13(14)19-16(23)20-17(2,3)8-7-15(21)22/h5-6,9,11H,7-8,10H2,1-4H3,(H,21,22)(H2,19,20,23) |
| InChIKey | HAAGRIMCVMJQCF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |