C15H19Cl2NO4 — CID 119203778
4-[2-(2,4-dichlorophenoxy)propanoylamino]-4-methylpentanoic acid (PubChem CID 119203778) has the molecular formula C15H19Cl2NO4 and a molecular weight of 348.23 g/mol. Its IUPAC name is 4-[2-(2,4-dichlorophenoxy)propanoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[2-(2,4-dichlorophenoxy)propanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119203778 |
| Molecular Formula | C15H19Cl2NO4 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 4-[2-(2,4-dichlorophenoxy)propanoylamino]-4-methylpentanoic acid |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C15H19Cl2NO4/c1-9(22-12-5-4-10(16)8-11(12)17)14(21)18-15(2,3)7-6-13(19)20/h4-5,8-9H,6-7H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | NDHMBBRYIOSNES-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |