C15H22ClNO5S — CID 155949381
N-[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]sulfonyl-2-methylbutanamide (PubChem CID 155949381) has the molecular formula C15H22ClNO5S and a molecular weight of 363.86 g/mol. Its IUPAC name is N-[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]sulfonyl-2-methylbutanamide.
| Compound Name | N-[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]sulfonyl-2-methylbutanamide |
|---|---|
| PubChem CID | 155949381 |
| Molecular Formula | C15H22ClNO5S |
| Molecular Weight | 363.86 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]sulfonyl-2-methylbutanamide |
| SMILES | CCC(C)C(=O)NS(=O)(=O)c1cc(Cl)ccc1OC(C)COC |
| InChI | InChI=1S/C15H22ClNO5S/c1-5-10(2)15(18)17-23(19,20)14-8-12(16)6-7-13(14)22-11(3)9-21-4/h6-8,10-11H,5,9H2,1-4H3,(H,17,18) |
| InChIKey | ACLZYMMIZRRSMV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.86 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |