C11H14ClNO5S — CID 167798625
N-[5-chloro-2-(2-methoxyethoxy)phenyl]sulfonylacetamide (PubChem CID 167798625) has the molecular formula C11H14ClNO5S and a molecular weight of 307.76 g/mol. Its IUPAC name is N-[5-chloro-2-(2-methoxyethoxy)phenyl]sulfonylacetamide.
| Compound Name | N-[5-chloro-2-(2-methoxyethoxy)phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 167798625 |
| Molecular Formula | C11H14ClNO5S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | N-[5-chloro-2-(2-methoxyethoxy)phenyl]sulfonylacetamide |
| SMILES | COCCOc1ccc(Cl)cc1S(=O)(=O)NC(C)=O |
| InChI | InChI=1S/C11H14ClNO5S/c1-8(14)13-19(15,16)11-7-9(12)3-4-10(11)18-6-5-17-2/h3-4,7H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | ZIJONWBFRVRGQV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|