C14H16ClNO6S — CID 155945670
N-[5-chloro-2-(2-methoxyethoxy)phenyl]sulfonyl-2,3-dihydrofuran-4-carboxamide (PubChem CID 155945670) has the molecular formula C14H16ClNO6S and a molecular weight of 361.80 g/mol. Its IUPAC name is N-[5-chloro-2-(2-methoxyethoxy)phenyl]sulfonyl-2,3-dihydrofuran-4-carboxamide.
| Compound Name | N-[5-chloro-2-(2-methoxyethoxy)phenyl]sulfonyl-2,3-dihydrofuran-4-carboxamide |
|---|---|
| PubChem CID | 155945670 |
| Molecular Formula | C14H16ClNO6S |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-[5-chloro-2-(2-methoxyethoxy)phenyl]sulfonyl-2,3-dihydrofuran-4-carboxamide |
| SMILES | COCCOc1ccc(Cl)cc1S(=O)(=O)NC(=O)C1=COCC1 |
| InChI | InChI=1S/C14H16ClNO6S/c1-20-6-7-22-12-3-2-11(15)8-13(12)23(18,19)16-14(17)10-4-5-21-9-10/h2-3,8-9H,4-7H2,1H3,(H,16,17) |
| InChIKey | JFAVVBBIGUPLKC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|