C14H20ClNO6S — CID 155949392
N-[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]sulfonyl-2-methoxypropanamide (PubChem CID 155949392) has the molecular formula C14H20ClNO6S and a molecular weight of 365.84 g/mol. Its IUPAC name is N-[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]sulfonyl-2-methoxypropanamide.
| Compound Name | N-[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]sulfonyl-2-methoxypropanamide |
|---|---|
| PubChem CID | 155949392 |
| Molecular Formula | C14H20ClNO6S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]sulfonyl-2-methoxypropanamide |
| SMILES | COCC(C)Oc1ccc(Cl)cc1S(=O)(=O)NC(=O)C(C)OC |
| InChI | InChI=1S/C14H20ClNO6S/c1-9(8-20-3)22-12-6-5-11(15)7-13(12)23(18,19)16-14(17)10(2)21-4/h5-7,9-10H,8H2,1-4H3,(H,16,17) |
| InChIKey | SBSWKXDOEXWZHT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |