C13H17F3N2O2 — CID 115518960
5,5,5-trifluoro-N-[(2-methyl-3-nitrophenyl)methyl]pentan-1-amine (PubChem CID 115518960) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 5,5,5-trifluoro-N-[(2-methyl-3-nitrophenyl)methyl]pentan-1-amine.
| Compound Name | 5,5,5-trifluoro-N-[(2-methyl-3-nitrophenyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 115518960 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 5,5,5-trifluoro-N-[(2-methyl-3-nitrophenyl)methyl]pentan-1-amine |
| SMILES | Cc1c(CNCCCCC(F)(F)F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17F3N2O2/c1-10-11(5-4-6-12(10)18(19)20)9-17-8-3-2-7-13(14,15)16/h4-6,17H,2-3,7-9H2,1H3 |
| InChIKey | AKIVKIPKCCDIHA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|