C12H18N4O3 — CID 103110735
N'-hydroxy-4-[(2-methyl-3-nitrophenyl)methylamino]butanimidamide (PubChem CID 103110735) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is N'-hydroxy-4-[(2-methyl-3-nitrophenyl)methylamino]butanimidamide.
| Compound Name | N'-hydroxy-4-[(2-methyl-3-nitrophenyl)methylamino]butanimidamide |
|---|---|
| PubChem CID | 103110735 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N'-hydroxy-4-[(2-methyl-3-nitrophenyl)methylamino]butanimidamide |
| SMILES | Cc1c(CNCCC/C(N)=N/O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O3/c1-9-10(4-2-5-11(9)16(18)19)8-14-7-3-6-12(13)15-17/h2,4-5,14,17H,3,6-8H2,1H3,(H2,13,15) |
| InChIKey | XVYMUBLZSDEKSC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|