C17H16N4O6 — CID 2812064
ethyl 1-methyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]-5-nitroindole-2-carboxylate (PubChem CID 2812064) has the molecular formula C17H16N4O6 and a molecular weight of 372.34 g/mol. Its IUPAC name is ethyl 1-methyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]-5-nitroindole-2-carboxylate.
| Compound Name | ethyl 1-methyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]-5-nitroindole-2-carboxylate |
|---|---|
| PubChem CID | 2812064 |
| Molecular Formula | C17H16N4O6 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | ethyl 1-methyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]-5-nitroindole-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cc(C)on2)c2cc([N+](=O)[O-])ccc2n1C |
| InChI | InChI=1S/C17H16N4O6/c1-4-26-17(23)15-14(18-16(22)12-7-9(2)27-19-12)11-8-10(21(24)25)5-6-13(11)20(15)3/h5-8H,4H2,1-3H3,(H,18,22) |
| InChIKey | TXYZJUYONKONNO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|