C15H11N3O2 — CID 13037309
ethyl 5-cyano-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 13037309) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is ethyl 5-cyano-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 5-cyano-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 13037309 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | ethyl 5-cyano-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cn1)[nH]c1cccc(C#N)c12 |
| InChI | InChI=1S/C15H11N3O2/c1-2-20-15(19)12-6-10-13(8-17-12)18-11-5-3-4-9(7-16)14(10)11/h3-6,8,18H,2H2,1H3 |
| InChIKey | FBYCPOKTFVGCJS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |