C11H8FN3 — CID 115022160
6-fluoro-9H-pyrido[3,4-b]indol-3-amine (PubChem CID 115022160) has the molecular formula C11H8FN3 and a molecular weight of 201.20 g/mol. Its IUPAC name is 6-fluoro-9H-pyrido[3,4-b]indol-3-amine.
| Compound Name | 6-fluoro-9H-pyrido[3,4-b]indol-3-amine |
|---|---|
| PubChem CID | 115022160 |
| Molecular Formula | C11H8FN3 |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 6-fluoro-9H-pyrido[3,4-b]indol-3-amine |
| SMILES | Nc1cc2c(cn1)[nH]c1ccc(F)cc12 |
| InChI | InChI=1S/C11H8FN3/c12-6-1-2-9-7(3-6)8-4-11(13)14-5-10(8)15-9/h1-5,15H,(H2,13,14) |
| InChIKey | UEAUZDNDKUXLGO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |