About 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole
5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole (PubChem CID 175168061) has the molecular formula C14H8FN3S
and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole |
| PubChem CID | 175168061 |
| Molecular Formula | C14H8FN3S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole |
| SMILES | Fc1ccc2[nH]c3c(-c4cncs4)nccc3c2c1 |
| InChI | InChI=1S/C14H8FN3S/c15-8-1-2-11-10(5-8)9-3-4-17-14(13(9)18-11)12-6-16-7-19-12/h1-7,18H |
| InChIKey | XSBUIYCFZVRNOM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole?
The IUPAC name of 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole (CID 175168061) is 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole.
What is the SMILES notation for 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole?
The canonical SMILES for 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole is Fc1ccc2[nH]c3c(-c4cncs4)nccc3c2c1.
What is the InChIKey of 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole?
The InChIKey is XSBUIYCFZVRNOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8FN3S/c15-8-1-2-11-10(5-8)9-3-4-17-14(13(9)18-11)12-6-16-7-19-12/h1-7,18H.
What are the key properties of 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole?
5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole has a molecular weight of 269.30 g/mol, XLogP of 3.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-fluoro-9H-pyrido[3,4-b]indol-1-yl)-1,3-thiazole is sourced from PubChem (CID 175168061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).