C11H6FN3OS — CID 154805156
6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one (PubChem CID 154805156) has the molecular formula C11H6FN3OS and a molecular weight of 247.25 g/mol. Its IUPAC name is 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one.
| Compound Name | 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 154805156 |
| Molecular Formula | C11H6FN3OS |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2cncs2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C11H6FN3OS/c12-6-1-2-8-7(3-6)11(16)15-10(14-8)9-4-13-5-17-9/h1-5H,(H,14,15,16) |
| InChIKey | PASPONORFQFFOG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |