About 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one
6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one (PubChem CID 154805156) has the molecular formula C11H6FN3OS
and a molecular weight of 247.25 g/mol. Its IUPAC name is 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one |
| PubChem CID | 154805156 |
| Molecular Formula | C11H6FN3OS |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2cncs2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C11H6FN3OS/c12-6-1-2-8-7(3-6)11(16)15-10(14-8)9-4-13-5-17-9/h1-5H,(H,14,15,16) |
| InChIKey | PASPONORFQFFOG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one?
The IUPAC name of 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one (CID 154805156) is 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one.
What is the SMILES notation for 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one?
The canonical SMILES for 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one is O=c1[nH]c(-c2cncs2)nc2ccc(F)cc12.
What is the InChIKey of 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one?
The InChIKey is PASPONORFQFFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6FN3OS/c12-6-1-2-8-7(3-6)11(16)15-10(14-8)9-4-13-5-17-9/h1-5H,(H,14,15,16).
What are the key properties of 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one?
6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one has a molecular weight of 247.25 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-(1,3-thiazol-5-yl)-3H-quinazolin-4-one is sourced from PubChem (CID 154805156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).