C12H9N3O — CID 23559431
3-amino-9H-pyrido[3,4-b]indole-6-carbaldehyde (PubChem CID 23559431) has the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-amino-9H-pyrido[3,4-b]indole-6-carbaldehyde.
| Compound Name | 3-amino-9H-pyrido[3,4-b]indole-6-carbaldehyde |
|---|---|
| PubChem CID | 23559431 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 3-amino-9H-pyrido[3,4-b]indole-6-carbaldehyde |
| SMILES | Nc1cc2c(cn1)[nH]c1ccc(C=O)cc12 |
| InChI | InChI=1S/C12H9N3O/c13-12-4-9-8-3-7(6-16)1-2-10(8)15-11(9)5-14-12/h1-6,15H,(H2,13,14) |
| InChIKey | VAQOEDDCKWJJIX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|