C15H13NO — CID 12733102
6,7-dimethyl-9H-carbazole-3-carbaldehyde (PubChem CID 12733102) has the molecular formula C15H13NO and a molecular weight of 223.28 g/mol. Its IUPAC name is 6,7-dimethyl-9H-carbazole-3-carbaldehyde.
| Compound Name | 6,7-dimethyl-9H-carbazole-3-carbaldehyde |
|---|---|
| PubChem CID | 12733102 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 6,7-dimethyl-9H-carbazole-3-carbaldehyde |
| SMILES | Cc1cc2[nH]c3ccc(C=O)cc3c2cc1C |
| InChI | InChI=1S/C15H13NO/c1-9-5-12-13-7-11(8-17)3-4-14(13)16-15(12)6-10(9)2/h3-8,16H,1-2H3 |
| InChIKey | SFPCUKVECLIZMA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|