C17H13NO — CID 57130109
6-buta-1,3-dienyl-9H-carbazole-3-carbaldehyde (PubChem CID 57130109) has the molecular formula C17H13NO and a molecular weight of 247.30 g/mol. Its IUPAC name is 6-buta-1,3-dienyl-9H-carbazole-3-carbaldehyde.
| Compound Name | 6-buta-1,3-dienyl-9H-carbazole-3-carbaldehyde |
|---|---|
| PubChem CID | 57130109 |
| Molecular Formula | C17H13NO |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 6-buta-1,3-dienyl-9H-carbazole-3-carbaldehyde |
| SMILES | C=CC=Cc1ccc2[nH]c3ccc(C=O)cc3c2c1 |
| InChI | InChI=1S/C17H13NO/c1-2-3-4-12-5-7-16-14(9-12)15-10-13(11-19)6-8-17(15)18-16/h2-11,18H,1H2 |
| InChIKey | KQDJZJXFOWONLA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|