About 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde
1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde (PubChem CID 174875105) has the molecular formula C16H13NO3
and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde |
| PubChem CID | 174875105 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde |
| SMILES | O=Cc1ccc2[nH]c3c(CCO)cc(C=O)cc3c2c1 |
| InChI | InChI=1S/C16H13NO3/c18-4-3-12-5-11(9-20)7-14-13-6-10(8-19)1-2-15(13)17-16(12)14/h1-2,5-9,17-18H,3-4H2 |
| InChIKey | PFHDGVYIOKGPQN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde?
The IUPAC name of 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde (CID 174875105) is 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde.
What is the SMILES notation for 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde?
The canonical SMILES for 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde is O=Cc1ccc2[nH]c3c(CCO)cc(C=O)cc3c2c1.
What is the InChIKey of 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde?
The InChIKey is PFHDGVYIOKGPQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3/c18-4-3-12-5-11(9-20)7-14-13-6-10(8-19)1-2-15(13)17-16(12)14/h1-2,5-9,17-18H,3-4H2.
What are the key properties of 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde?
1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde has a molecular weight of 267.28 g/mol, XLogP of 2.48, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)-9H-carbazole-3,6-dicarbaldehyde is sourced from PubChem (CID 174875105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).