C11H8ClN3 — CID 115030362
7-chloro-9H-pyrido[3,4-b]indol-3-amine (PubChem CID 115030362) has the molecular formula C11H8ClN3 and a molecular weight of 217.66 g/mol. Its IUPAC name is 7-chloro-9H-pyrido[3,4-b]indol-3-amine.
| Compound Name | 7-chloro-9H-pyrido[3,4-b]indol-3-amine |
|---|---|
| PubChem CID | 115030362 |
| Molecular Formula | C11H8ClN3 |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 7-chloro-9H-pyrido[3,4-b]indol-3-amine |
| SMILES | Nc1cc2c(cn1)[nH]c1cc(Cl)ccc12 |
| InChI | InChI=1S/C11H8ClN3/c12-6-1-2-7-8-4-11(13)14-5-10(8)15-9(7)3-6/h1-5,15H,(H2,13,14) |
| InChIKey | KVNDUHBSBDMDHB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |