C21H21N3O4 — CID 54050489
2-[[(3-ethoxycarbonyl-9H-pyrido[3,4-b]indol-6-yl)-prop-2-enylamino]methyl]prop-2-enoic acid (PubChem CID 54050489) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[[(3-ethoxycarbonyl-9H-pyrido[3,4-b]indol-6-yl)-prop-2-enylamino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[(3-ethoxycarbonyl-9H-pyrido[3,4-b]indol-6-yl)-prop-2-enylamino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54050489 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[[(3-ethoxycarbonyl-9H-pyrido[3,4-b]indol-6-yl)-prop-2-enylamino]methyl]prop-2-enoic acid |
| SMILES | C=CCN(CC(=C)C(=O)O)c1ccc2[nH]c3cnc(C(=O)OCC)cc3c2c1 |
| InChI | InChI=1S/C21H21N3O4/c1-4-8-24(12-13(3)20(25)26)14-6-7-17-15(9-14)16-10-18(21(27)28-5-2)22-11-19(16)23-17/h4,6-7,9-11,23H,1,3,5,8,12H2,2H3,(H,25,26) |
| InChIKey | LSNZCKKPQZYUMS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|