3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid

C20H17NO4 — CID 53487995

IUPAC3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid
SMILESO=C(O)c1ncc(OCc2ccccc2)cc1OCc1ccccc1
InChIInChI=1S/C20H17NO4/c22-20(23)19-18(25-14-16-9-5-2-6-10-16)11-17(12-21-19)24-13-15-7-3-1-4-8-15/h1-12H,13-14H2,(H,22,23)
InChIKeyOEJYKWLDGWAOIF-UHFFFAOYSA-N
MW335.36 g/mol
LogP3.94
Rot. Bonds7

About 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid

3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid (PubChem CID 53487995) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid
PubChem CID53487995
Molecular FormulaC20H17NO4
Molecular Weight335.36 g/mol
Exact Mass335.12
IUPAC Name3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid
SMILESO=C(O)c1ncc(OCc2ccccc2)cc1OCc1ccccc1
InChIInChI=1S/C20H17NO4/c22-20(23)19-18(25-14-16-9-5-2-6-10-16)11-17(12-21-19)24-13-15-7-3-1-4-8-15/h1-12H,13-14H2,(H,22,23)
InChIKeyOEJYKWLDGWAOIF-UHFFFAOYSA-N
XLogP3.94
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.36
LogP ≤ 53.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid?
The IUPAC name of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid (CID 53487995) is 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid.
What is the SMILES notation for 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid?
The canonical SMILES for 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid is O=C(O)c1ncc(OCc2ccccc2)cc1OCc1ccccc1.
What is the InChIKey of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid?
The InChIKey is OEJYKWLDGWAOIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO4/c22-20(23)19-18(25-14-16-9-5-2-6-10-16)11-17(12-21-19)24-13-15-7-3-1-4-8-15/h1-12H,13-14H2,(H,22,23).
What are the key properties of 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid?
3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid has a molecular weight of 335.36 g/mol, XLogP of 3.94, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(phenylmethoxy)pyridine-2-carboxylic acid is sourced from PubChem (CID 53487995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).