C18H16N2O4 — CID 177042268
3-(4-oxo-8-phenylmethoxy-3H-quinazolin-2-yl)propanoic acid (PubChem CID 177042268) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-(4-oxo-8-phenylmethoxy-3H-quinazolin-2-yl)propanoic acid.
| Compound Name | 3-(4-oxo-8-phenylmethoxy-3H-quinazolin-2-yl)propanoic acid |
|---|---|
| PubChem CID | 177042268 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-(4-oxo-8-phenylmethoxy-3H-quinazolin-2-yl)propanoic acid |
| SMILES | O=C(O)CCc1nc2c(OCc3ccccc3)cccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H16N2O4/c21-16(22)10-9-15-19-17-13(18(23)20-15)7-4-8-14(17)24-11-12-5-2-1-3-6-12/h1-8H,9-11H2,(H,21,22)(H,19,20,23) |
| InChIKey | SRUBGGFALKFRLB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |