C24H23NO3 — CID 150222270
4-(3-methylhex-1-ynyl)-8-phenylmethoxyquinoline-2-carboxylic acid (PubChem CID 150222270) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is 4-(3-methylhex-1-ynyl)-8-phenylmethoxyquinoline-2-carboxylic acid.
| Compound Name | 4-(3-methylhex-1-ynyl)-8-phenylmethoxyquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 150222270 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 4-(3-methylhex-1-ynyl)-8-phenylmethoxyquinoline-2-carboxylic acid |
| SMILES | CCCC(C)C#Cc1cc(C(=O)O)nc2c(OCc3ccccc3)cccc12 |
| InChI | InChI=1S/C24H23NO3/c1-3-8-17(2)13-14-19-15-21(24(26)27)25-23-20(19)11-7-12-22(23)28-16-18-9-5-4-6-10-18/h4-7,9-12,15,17H,3,8,16H2,1-2H3,(H,26,27) |
| InChIKey | FTSQPXALLQOYEM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|