C24H27ClN2O3 — CID 90944531
3-(3-aminopropoxy)-N-(2-butoxy-4-chlorophenyl)naphthalene-2-carboxamide (PubChem CID 90944531) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is 3-(3-aminopropoxy)-N-(2-butoxy-4-chlorophenyl)naphthalene-2-carboxamide.
| Compound Name | 3-(3-aminopropoxy)-N-(2-butoxy-4-chlorophenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 90944531 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3-(3-aminopropoxy)-N-(2-butoxy-4-chlorophenyl)naphthalene-2-carboxamide |
| SMILES | CCCCOc1cc(Cl)ccc1NC(=O)c1cc2ccccc2cc1OCCCN |
| InChI | InChI=1S/C24H27ClN2O3/c1-2-3-12-30-23-16-19(25)9-10-21(23)27-24(28)20-14-17-7-4-5-8-18(17)15-22(20)29-13-6-11-26/h4-5,7-10,14-16H,2-3,6,11-13,26H2,1H3,(H,27,28) |
| InChIKey | LMKWHHSWCNQFEY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|