C31H44ClN3O3 — CID 143981565
N-[2-[3-[(5-amino-2,2,4,4-tetramethylpentyl)amino]propoxy]-4-chlorophenyl]-3-hydroxynaphthalene-2-carboxamide;ethane (PubChem CID 143981565) has the molecular formula C31H44ClN3O3 and a molecular weight of 542.16 g/mol. Its IUPAC name is N-[2-[3-[(5-amino-2,2,4,4-tetramethylpentyl)amino]propoxy]-4-chlorophenyl]-3-hydroxynaphthalene-2-carboxamide;ethane.
| Compound Name | N-[2-[3-[(5-amino-2,2,4,4-tetramethylpentyl)amino]propoxy]-4-chlorophenyl]-3-hydroxynaphthalene-2-carboxamide;ethane |
|---|---|
| PubChem CID | 143981565 |
| Molecular Formula | C31H44ClN3O3 |
| Molecular Weight | 542.16 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | N-[2-[3-[(5-amino-2,2,4,4-tetramethylpentyl)amino]propoxy]-4-chlorophenyl]-3-hydroxynaphthalene-2-carboxamide;ethane |
| SMILES | CC.CC(C)(CN)CC(C)(C)CNCCCOc1cc(Cl)ccc1NC(=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C29H38ClN3O3.C2H6/c1-28(2,18-31)17-29(3,4)19-32-12-7-13-36-26-16-22(30)10-11-24(26)33-27(35)23-14-20-8-5-6-9-21(20)15-25(23)34;1-2/h5-6,8-11,14-16,32,34H,7,12-13,17-19,31H2,1-4H3,(H,33,35);1-2H3 |
| InChIKey | NDEGGKKQUWLLJW-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.16 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|