C34H32ClN3O5 — CID 167229831
3-(3-aminopropoxy)-N-[2-[3-[(4-chloro-2-hydroxyphenyl)carbamoyl]naphthalen-2-yl]oxyethyl]-6-methylnaphthalene-2-carboxamide (PubChem CID 167229831) has the molecular formula C34H32ClN3O5 and a molecular weight of 598.10 g/mol. Its IUPAC name is 3-(3-aminopropoxy)-N-[2-[3-[(4-chloro-2-hydroxyphenyl)carbamoyl]naphthalen-2-yl]oxyethyl]-6-methylnaphthalene-2-carboxamide.
| Compound Name | 3-(3-aminopropoxy)-N-[2-[3-[(4-chloro-2-hydroxyphenyl)carbamoyl]naphthalen-2-yl]oxyethyl]-6-methylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 167229831 |
| Molecular Formula | C34H32ClN3O5 |
| Molecular Weight | 598.10 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 3-(3-aminopropoxy)-N-[2-[3-[(4-chloro-2-hydroxyphenyl)carbamoyl]naphthalen-2-yl]oxyethyl]-6-methylnaphthalene-2-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NCCOc3cc4ccccc4cc3C(=O)Nc3ccc(Cl)cc3O)c(OCCCN)cc2c1 |
| InChI | InChI=1S/C34H32ClN3O5/c1-21-7-8-24-17-27(32(19-25(24)15-21)42-13-4-11-36)33(40)37-12-14-43-31-18-23-6-3-2-5-22(23)16-28(31)34(41)38-29-10-9-26(35)20-30(29)39/h2-3,5-10,15-20,39H,4,11-14,36H2,1H3,(H,37,40)(H,38,41) |
| InChIKey | VVPZYMIGJMZZRH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.10 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|