C23H14BrF3NO5- — CID 163123163
3-(4-bromophenyl)-7-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-2-(trifluoromethyl)chromen-4-one (PubChem CID 163123163) has the molecular formula C23H14BrF3NO5- and a molecular weight of 521.27 g/mol. Its IUPAC name is 3-(4-bromophenyl)-7-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(4-bromophenyl)-7-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 163123163 |
| Molecular Formula | C23H14BrF3NO5- |
| Molecular Weight | 521.27 g/mol |
| Exact Mass | 520.00 |
| IUPAC Name | 3-(4-bromophenyl)-7-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-2-(trifluoromethyl)chromen-4-one |
| SMILES | O=c1c(-c2ccc(Br)cc2)c(C(F)(F)F)oc2cc(OCc3ccc(N([O-])O)cc3)ccc12 |
| InChI | InChI=1S/C23H14BrF3NO5/c24-15-5-3-14(4-6-15)20-21(29)18-10-9-17(11-19(18)33-22(20)23(25,26)27)32-12-13-1-7-16(8-2-13)28(30)31/h1-11,30H,12H2/q-1 |
| InChIKey | VKAAIBLBPUSOEE-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.27 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|