C8H16N8O — CID 110178349
[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]urea (PubChem CID 110178349) has the molecular formula C8H16N8O and a molecular weight of 240.27 g/mol. Its IUPAC name is [[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]urea.
| Compound Name | [[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]urea |
|---|---|
| PubChem CID | 110178349 |
| Molecular Formula | C8H16N8O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]urea |
| SMILES | CCNc1nc(NCC)nc(NNC(N)=O)n1 |
| InChI | InChI=1S/C8H16N8O/c1-3-10-6-12-7(11-4-2)14-8(13-6)16-15-5(9)17/h3-4H2,1-2H3,(H3,9,15,17)(H3,10,11,12,13,14,16) |
| InChIKey | FMILJUZNGQVTDP-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|