C9H18N8O — CID 18523914
2-[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-1-methoxyguanidine (PubChem CID 18523914) has the molecular formula C9H18N8O and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-1-methoxyguanidine.
| Compound Name | 2-[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-1-methoxyguanidine |
|---|---|
| PubChem CID | 18523914 |
| Molecular Formula | C9H18N8O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-1-methoxyguanidine |
| SMILES | CCNc1nc(/N=C(/N)NOC)nc(NCC)n1 |
| InChI | InChI=1S/C9H18N8O/c1-4-11-7-14-8(12-5-2)16-9(15-7)13-6(10)17-18-3/h4-5H2,1-3H3,(H5,10,11,12,13,14,15,16,17) |
| InChIKey | PCQAREOWCHWFOA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|