C7H12N6O3 — CID 19911828
2-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxyguanidine (PubChem CID 19911828) has the molecular formula C7H12N6O3 and a molecular weight of 228.21 g/mol. Its IUPAC name is 2-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxyguanidine.
| Compound Name | 2-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxyguanidine |
|---|---|
| PubChem CID | 19911828 |
| Molecular Formula | C7H12N6O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxyguanidine |
| SMILES | CON/C(N)=N\c1nc(OC)nc(OC)n1 |
| InChI | InChI=1S/C7H12N6O3/c1-14-6-10-5(9-4(8)13-16-3)11-7(12-6)15-2/h1-3H3,(H3,8,9,10,11,12,13) |
| InChIKey | OMCLRNODOJLVCB-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|