C16H22N8O — CID 166386185
N'-[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-1-pyridin-2-ylcyclopropane-1-carbohydrazide (PubChem CID 166386185) has the molecular formula C16H22N8O and a molecular weight of 342.41 g/mol. Its IUPAC name is N'-[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-1-pyridin-2-ylcyclopropane-1-carbohydrazide.
| Compound Name | N'-[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-1-pyridin-2-ylcyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 166386185 |
| Molecular Formula | C16H22N8O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N'-[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-1-pyridin-2-ylcyclopropane-1-carbohydrazide |
| SMILES | CCNc1nc(NCC)nc(NNC(=O)C2(c3ccccn3)CC2)n1 |
| InChI | InChI=1S/C16H22N8O/c1-3-17-13-20-14(18-4-2)22-15(21-13)24-23-12(25)16(8-9-16)11-7-5-6-10-19-11/h5-7,10H,3-4,8-9H2,1-2H3,(H,23,25)(H3,17,18,20,21,22,24) |
| InChIKey | SZYUYWBONKJQQO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|