C9H18N8S — CID 71692745
1-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]-3-methylthiourea (PubChem CID 71692745) has the molecular formula C9H18N8S and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]-3-methylthiourea.
| Compound Name | 1-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 71692745 |
| Molecular Formula | C9H18N8S |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]-3-methylthiourea |
| SMILES | CCNc1nc(NCC)nc(NNC(=S)NC)n1 |
| InChI | InChI=1S/C9H18N8S/c1-4-11-6-13-7(12-5-2)15-8(14-6)16-17-9(18)10-3/h4-5H2,1-3H3,(H2,10,17,18)(H3,11,12,13,14,15,16) |
| InChIKey | CQHYSUWAGMCERQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|