C8H15N7O — CID 14509141
N-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]formamide (PubChem CID 14509141) has the molecular formula C8H15N7O and a molecular weight of 225.26 g/mol. Its IUPAC name is N-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]formamide.
| Compound Name | N-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]formamide |
|---|---|
| PubChem CID | 14509141 |
| Molecular Formula | C8H15N7O |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-[[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]amino]formamide |
| SMILES | CCNc1nc(NCC)nc(NNC=O)n1 |
| InChI | InChI=1S/C8H15N7O/c1-3-9-6-12-7(10-4-2)14-8(13-6)15-11-5-16/h5H,3-4H2,1-2H3,(H,11,16)(H3,9,10,12,13,14,15) |
| InChIKey | LWJOERZHZJZQFS-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|