C12H21ClN6O3 — CID 21434566
2-[[4-chloro-6-(3-methoxypropylamino)-1,3,5-triazin-2-yl]amino]ethyl N-ethylcarbamate (PubChem CID 21434566) has the molecular formula C12H21ClN6O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is 2-[[4-chloro-6-(3-methoxypropylamino)-1,3,5-triazin-2-yl]amino]ethyl N-ethylcarbamate.
| Compound Name | 2-[[4-chloro-6-(3-methoxypropylamino)-1,3,5-triazin-2-yl]amino]ethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 21434566 |
| Molecular Formula | C12H21ClN6O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-[[4-chloro-6-(3-methoxypropylamino)-1,3,5-triazin-2-yl]amino]ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCNc1nc(Cl)nc(NCCCOC)n1 |
| InChI | InChI=1S/C12H21ClN6O3/c1-3-14-12(20)22-8-6-16-11-18-9(13)17-10(19-11)15-5-4-7-21-2/h3-8H2,1-2H3,(H,14,20)(H2,15,16,17,18,19) |
| InChIKey | KPNXBQGUPKQIPY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|