C12H21ClN6O2S — CID 21434523
S-[2-[[4-chloro-6-(2-methoxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl] N-propan-2-ylcarbamothioate (PubChem CID 21434523) has the molecular formula C12H21ClN6O2S and a molecular weight of 348.86 g/mol. Its IUPAC name is S-[2-[[4-chloro-6-(2-methoxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl] N-propan-2-ylcarbamothioate.
| Compound Name | S-[2-[[4-chloro-6-(2-methoxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl] N-propan-2-ylcarbamothioate |
|---|---|
| PubChem CID | 21434523 |
| Molecular Formula | C12H21ClN6O2S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | S-[2-[[4-chloro-6-(2-methoxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl] N-propan-2-ylcarbamothioate |
| SMILES | COCCNc1nc(Cl)nc(NCCSC(=O)NC(C)C)n1 |
| InChI | InChI=1S/C12H21ClN6O2S/c1-8(2)16-12(20)22-7-5-15-11-18-9(13)17-10(19-11)14-4-6-21-3/h8H,4-7H2,1-3H3,(H,16,20)(H2,14,15,17,18,19) |
| InChIKey | UTDDDBHFNCHDGV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|