C12H21ClN6O3 — CID 21434532
2-[[4-chloro-6-(2-methoxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl N-propan-2-ylcarbamate (PubChem CID 21434532) has the molecular formula C12H21ClN6O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is 2-[[4-chloro-6-(2-methoxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl N-propan-2-ylcarbamate.
| Compound Name | 2-[[4-chloro-6-(2-methoxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 21434532 |
| Molecular Formula | C12H21ClN6O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-[[4-chloro-6-(2-methoxyethylamino)-1,3,5-triazin-2-yl]amino]ethyl N-propan-2-ylcarbamate |
| SMILES | COCCNc1nc(Cl)nc(NCCOC(=O)NC(C)C)n1 |
| InChI | InChI=1S/C12H21ClN6O3/c1-8(2)16-12(20)22-7-5-15-11-18-9(13)17-10(19-11)14-4-6-21-3/h8H,4-7H2,1-3H3,(H,16,20)(H2,14,15,17,18,19) |
| InChIKey | YVEACVFKTWIQJV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|